C21H20F3N5O — CID 54766398
N-ethyl-4-[6-ethynyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide (PubChem CID 54766398) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is N-ethyl-4-[6-ethynyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide.
| Compound Name | N-ethyl-4-[6-ethynyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 54766398 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-ethyl-4-[6-ethynyl-8-(3,3,3-trifluoropropylamino)imidazo[1,2-a]pyrazin-3-yl]-2-methylbenzamide |
| SMILES | C#Cc1cn2c(-c3ccc(C(=O)NCC)c(C)c3)cnc2c(NCCC(F)(F)F)n1 |
| InChI | InChI=1S/C21H20F3N5O/c1-4-15-12-29-17(14-6-7-16(13(3)10-14)20(30)25-5-2)11-27-19(29)18(28-15)26-9-8-21(22,23)24/h1,6-7,10-12H,5,8-9H2,2-3H3,(H,25,30)(H,26,28) |
| InChIKey | VPJBMBIMMBMVTG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|