About copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one)
copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) (PubChem CID 5476649) has the molecular formula C18H22CuN2O2
and a molecular weight of 361.93 g/mol. Its IUPAC name is copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one).
Molecular Properties
| Compound Name | copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) |
| PubChem CID | 5476649 |
| Molecular Formula | C18H22CuN2O2 |
| Molecular Weight | 361.93 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) |
| SMILES | CCN/C=C1/C=CC=CC1=O.CCN/C=C1/C=CC=CC1=O.[Cu] |
| InChI | InChI=1S/2C9H11NO.Cu/c2*1-2-10-7-8-5-3-4-6-9(8)11;/h2*3-7,10H,2H2,1H3;/b2*8-7-; |
| InChIKey | CILCNDVSASKITK-ATMONBRVSA-N |
| XLogP | 2.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.93 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one)?
The IUPAC name of copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) (CID 5476649) is copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one).
What is the SMILES notation for copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one)?
The canonical SMILES for copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) is CCN/C=C1/C=CC=CC1=O.CCN/C=C1/C=CC=CC1=O.[Cu].
What is the InChIKey of copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one)?
The InChIKey is CILCNDVSASKITK-ATMONBRVSA-N. The full InChI is InChI=1S/2C9H11NO.Cu/c2*1-2-10-7-8-5-3-4-6-9(8)11;/h2*3-7,10H,2H2,1H3;/b2*8-7-;.
What are the key properties of copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one)?
copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) has a molecular weight of 361.93 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis((6Z)-6-(ethylaminomethylidene)cyclohexa-2,4-dien-1-one) is sourced from PubChem (CID 5476649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).