C30H26N6O3 — CID 54766568
7-(2-methoxyethoxy)-4-[2-methyl-3-(quinazolin-4-ylamino)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide (PubChem CID 54766568) has the molecular formula C30H26N6O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-4-[2-methyl-3-(quinazolin-4-ylamino)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide.
| Compound Name | 7-(2-methoxyethoxy)-4-[2-methyl-3-(quinazolin-4-ylamino)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide |
|---|---|
| PubChem CID | 54766568 |
| Molecular Formula | C30H26N6O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 7-(2-methoxyethoxy)-4-[2-methyl-3-(quinazolin-4-ylamino)phenyl]-9H-pyrido[3,4-b]indole-1-carboxamide |
| SMILES | COCCOc1ccc2c(c1)[nH]c1c(C(N)=O)ncc(-c3cccc(Nc4ncnc5ccccc45)c3C)c12 |
| InChI | InChI=1S/C30H26N6O3/c1-17-19(7-5-9-23(17)36-30-21-6-3-4-8-24(21)33-16-34-30)22-15-32-28(29(31)37)27-26(22)20-11-10-18(14-25(20)35-27)39-13-12-38-2/h3-11,14-16,35H,12-13H2,1-2H3,(H2,31,37)(H,33,34,36) |
| InChIKey | VACYWAPGLLAEQI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|