C9H18O4S2 — CID 54766604
(1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol (PubChem CID 54766604) has the molecular formula C9H18O4S2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 54766604 |
| Molecular Formula | C9H18O4S2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (1R,2R,3S,4S)-1-(1,3-dithian-2-yl)pentane-1,2,3,4-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C9H18O4S2/c1-5(10)6(11)7(12)8(13)9-14-3-2-4-15-9/h5-13H,2-4H2,1H3/t5-,6-,7+,8+/m0/s1 |
| InChIKey | XRQZTKNYGNWEMB-RULNZFCNSA-N |
| XLogP | -0.35 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |