About 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one (PubChem CID 54766726) has the molecular formula C17H15FN6O2
and a molecular weight of 354.35 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one |
| PubChem CID | 54766726 |
| Molecular Formula | C17H15FN6O2 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-c3cnc4ccc(F)cn34)nc2n1C1CCOCC1 |
| InChI | InChI=1S/C17H15FN6O2/c18-10-1-2-14-19-8-13(23(14)9-10)15-20-7-12-16(22-15)24(17(25)21-12)11-3-5-26-6-4-11/h1-2,7-9,11H,3-6H2,(H,21,25) |
| InChIKey | NTFXSLRFNIPLJJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one?
The IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one (CID 54766726) is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one.
What is the SMILES notation for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one?
The canonical SMILES for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one is O=c1[nH]c2cnc(-c3cnc4ccc(F)cn34)nc2n1C1CCOCC1.
What is the InChIKey of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one?
The InChIKey is NTFXSLRFNIPLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN6O2/c18-10-1-2-14-19-8-13(23(14)9-10)15-20-7-12-16(22-15)24(17(25)21-12)11-3-5-26-6-4-11/h1-2,7-9,11H,3-6H2,(H,21,25).
What are the key properties of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one?
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one has a molecular weight of 354.35 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(oxan-4-yl)-7H-purin-8-one is sourced from PubChem (CID 54766726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).