About 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide
9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide (PubChem CID 54766733) has the molecular formula C33H28BrFN2O
and a molecular weight of 567.50 g/mol. Its IUPAC name is 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide.
Molecular Properties
| Compound Name | 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide |
| PubChem CID | 54766733 |
| Molecular Formula | C33H28BrFN2O |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide |
| SMILES | Cc1c2c(cc[n+]1Cc1ccccc1F)c1ccc(OCc3ccccc3)cc1n2Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C33H28FN2O.BrH/c1-24-33-30(18-19-35(24)22-27-14-8-9-15-31(27)34)29-17-16-28(37-23-26-12-6-3-7-13-26)20-32(29)36(33)21-25-10-4-2-5-11-25;/h2-20H,21-23H2,1H3;1H/q+1;/p-1 |
| InChIKey | QFZTVBUSKCUSJG-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide?
The IUPAC name of 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide (CID 54766733) is 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide.
What is the SMILES notation for 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide?
The canonical SMILES for 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide is Cc1c2c(cc[n+]1Cc1ccccc1F)c1ccc(OCc3ccccc3)cc1n2Cc1ccccc1.[Br-].
What is the InChIKey of 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide?
The InChIKey is QFZTVBUSKCUSJG-UHFFFAOYSA-M. The full InChI is InChI=1S/C33H28FN2O.BrH/c1-24-33-30(18-19-35(24)22-27-14-8-9-15-31(27)34)29-17-16-28(37-23-26-12-6-3-7-13-26)20-32(29)36(33)21-25-10-4-2-5-11-25;/h2-20H,21-23H2,1H3;1H/q+1;/p-1.
What are the key properties of 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide?
9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide has a molecular weight of 567.50 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-2-[(2-fluorophenyl)methyl]-1-methyl-7-phenylmethoxypyrido[3,4-b]indol-2-ium bromide is sourced from PubChem (CID 54766733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).