About bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc
bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc (PubChem CID 5476676) has the molecular formula C24H34N2O2Zn
and a molecular weight of 447.94 g/mol. Its IUPAC name is bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc.
Molecular Properties
| Compound Name | bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc |
| PubChem CID | 5476676 |
| Molecular Formula | C24H34N2O2Zn |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc |
| SMILES | CC(C)CCN/C=C1/C=CC=CC1=O.CC(C)CCN/C=C1/C=CC=CC1=O.[Zn] |
| InChI | InChI=1S/2C12H17NO.Zn/c2*1-10(2)7-8-13-9-11-5-3-4-6-12(11)14;/h2*3-6,9-10,13H,7-8H2,1-2H3;/b2*11-9-; |
| InChIKey | OFCANNMWAQKNNH-UNNWALPCSA-N |
| XLogP | 4.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc?
The IUPAC name of bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc (CID 5476676) is bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc.
What is the SMILES notation for bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc?
The canonical SMILES for bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc is CC(C)CCN/C=C1/C=CC=CC1=O.CC(C)CCN/C=C1/C=CC=CC1=O.[Zn].
What is the InChIKey of bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc?
The InChIKey is OFCANNMWAQKNNH-UNNWALPCSA-N. The full InChI is InChI=1S/2C12H17NO.Zn/c2*1-10(2)7-8-13-9-11-5-3-4-6-12(11)14;/h2*3-6,9-10,13H,7-8H2,1-2H3;/b2*11-9-;.
What are the key properties of bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc?
bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc has a molecular weight of 447.94 g/mol, XLogP of 4.40, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((6Z)-6-[(3-methylbutylamino)methylidene]cyclohexa-2,4-dien-1-one);zinc is sourced from PubChem (CID 5476676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).