C33H63NO2 — CID 54766860
1-[(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-octoxypropan-2-yl]pyrrolidine (PubChem CID 54766860) has the molecular formula C33H63NO2 and a molecular weight of 505.87 g/mol. Its IUPAC name is 1-[(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-octoxypropan-2-yl]pyrrolidine.
| Compound Name | 1-[(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-octoxypropan-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 54766860 |
| Molecular Formula | C33H63NO2 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 505.49 |
| IUPAC Name | 1-[(2S)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-octoxypropan-2-yl]pyrrolidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@H](COCCCCCCCC)N1CCCC1 |
| InChI | InChI=1S/C33H63NO2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-26-30-36-32-33(34-27-23-24-28-34)31-35-29-25-21-10-8-6-4-2/h11-12,14-15,33H,3-10,13,16-32H2,1-2H3/b12-11-,15-14-/t33-/m0/s1 |
| InChIKey | AVCZOJGYRPKDBU-HDSMTYSLSA-N |
| XLogP | 9.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|