About 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine
3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine (PubChem CID 54767242) has the molecular formula C16H24Cl2N2
and a molecular weight of 315.29 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine |
| PubChem CID | 54767242 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine |
| SMILES | CN(C)CCC(c1ccc(Cl)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-19(2)11-8-16(20-9-4-3-5-10-20)13-6-7-14(17)15(18)12-13/h6-7,12,16H,3-5,8-11H2,1-2H3 |
| InChIKey | JDOZNEHOYKLUQH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine?
The IUPAC name of 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine (CID 54767242) is 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine?
The canonical SMILES for 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine is CN(C)CCC(c1ccc(Cl)c(Cl)c1)N1CCCCC1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine?
The InChIKey is JDOZNEHOYKLUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24Cl2N2/c1-19(2)11-8-16(20-9-4-3-5-10-20)13-6-7-14(17)15(18)12-13/h6-7,12,16H,3-5,8-11H2,1-2H3.
What are the key properties of 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine?
3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine has a molecular weight of 315.29 g/mol, XLogP of 4.47, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-N,N-dimethyl-3-piperidin-1-ylpropan-1-amine is sourced from PubChem (CID 54767242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).