C23H26N6O3 — CID 54767329
4-[8-(3-aminopropylamino)-6-(3-hydroxyprop-1-ynyl)imidazo[1,2-a]pyrazin-3-yl]-N-cyclopropyl-3-methoxybenzamide (PubChem CID 54767329) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-[8-(3-aminopropylamino)-6-(3-hydroxyprop-1-ynyl)imidazo[1,2-a]pyrazin-3-yl]-N-cyclopropyl-3-methoxybenzamide.
| Compound Name | 4-[8-(3-aminopropylamino)-6-(3-hydroxyprop-1-ynyl)imidazo[1,2-a]pyrazin-3-yl]-N-cyclopropyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 54767329 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4-[8-(3-aminopropylamino)-6-(3-hydroxyprop-1-ynyl)imidazo[1,2-a]pyrazin-3-yl]-N-cyclopropyl-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CC2)ccc1-c1cnc2c(NCCCN)nc(C#CCO)cn12 |
| InChI | InChI=1S/C23H26N6O3/c1-32-20-12-15(23(31)28-16-6-7-16)5-8-18(20)19-13-26-22-21(25-10-3-9-24)27-17(4-2-11-30)14-29(19)22/h5,8,12-14,16,30H,3,6-7,9-11,24H2,1H3,(H,25,27)(H,28,31) |
| InChIKey | VSBWTEAIJSJNCM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|