C33H65NO2 — CID 54767331
(2R)-1-(3,7-dimethyloctoxy)-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine (PubChem CID 54767331) has the molecular formula C33H65NO2 and a molecular weight of 507.89 g/mol. Its IUPAC name is (2R)-1-(3,7-dimethyloctoxy)-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine.
| Compound Name | (2R)-1-(3,7-dimethyloctoxy)-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
|---|---|
| PubChem CID | 54767331 |
| Molecular Formula | C33H65NO2 |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.50 |
| IUPAC Name | (2R)-1-(3,7-dimethyloctoxy)-N,N-dimethyl-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@H](COCCC(C)CCCC(C)C)N(C)C |
| InChI | InChI=1S/C33H65NO2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-35-29-33(34(5)6)30-36-28-26-32(4)25-23-24-31(2)3/h11-12,14-15,31-33H,7-10,13,16-30H2,1-6H3/b12-11-,15-14-/t32?,33-/m1/s1 |
| InChIKey | JDQVUHMYUPHIKQ-OUVOGOSVSA-N |
| XLogP | 9.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|