C25H41NO4Si — CID 54768060
(4S)-4-benzyl-3-[(4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 54768060) has the molecular formula C25H41NO4Si and a molecular weight of 447.69 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54768060 |
| Molecular Formula | C25H41NO4Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (4S)-4-benzyl-3-[(4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CCC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H41NO4Si/c1-19(15-20(2)17-30-31(6,7)25(3,4)5)13-14-23(27)26-22(18-29-24(26)28)16-21-11-9-8-10-12-21/h8-12,19-20,22H,13-18H2,1-7H3/t19-,20-,22+/m1/s1 |
| InChIKey | BZILXABGHDCMAM-SJBKTWHCSA-N |
| XLogP | 6.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|