C27H52O4Si2 — CID 54768105
(3S,4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde (PubChem CID 54768105) has the molecular formula C27H52O4Si2 and a molecular weight of 496.88 g/mol. Its IUPAC name is (3S,4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | (3S,4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 54768105 |
| Molecular Formula | C27H52O4Si2 |
| Molecular Weight | 496.88 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (3S,4aR,5R,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carbaldehyde |
| SMILES | CC1=C(C=O)[C@@]2(C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C27H52O4Si2/c1-19-20(17-28)26(8)15-14-23(31-33(12,13)25(5,6)7)27(9,22(26)16-21(19)29)18-30-32(10,11)24(2,3)4/h17,21-23,29H,14-16,18H2,1-13H3/t21-,22+,23-,26+,27-/m0/s1 |
| InChIKey | PJOPFKZXWXXVEB-JOGPZLGXSA-N |
| XLogP | 7.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.88 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|