C16H8F3NO — CID 54768129
5-(trifluoromethyl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-one (PubChem CID 54768129) has the molecular formula C16H8F3NO and a molecular weight of 287.24 g/mol. Its IUPAC name is 5-(trifluoromethyl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-one.
| Compound Name | 5-(trifluoromethyl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-one |
|---|---|
| PubChem CID | 54768129 |
| Molecular Formula | C16H8F3NO |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-(trifluoromethyl)-11-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1,3,5,7,9(16),12,14-heptaen-10-one |
| SMILES | O=C1Nc2cccc3c2c1cc1cc(C(F)(F)F)ccc13 |
| InChI | InChI=1S/C16H8F3NO/c17-16(18,19)9-4-5-10-8(6-9)7-12-14-11(10)2-1-3-13(14)20-15(12)21/h1-7H,(H,20,21) |
| InChIKey | UZYDPPZESULXJP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|