About 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol
2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol (PubChem CID 54768181) has the molecular formula C18H19NO5
and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol.
Molecular Properties
| Compound Name | 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol |
| PubChem CID | 54768181 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol |
| SMILES | COc1ccc(-n2ccc3c(OC)c(OC)c(OC)cc32)cc1O |
| InChI | InChI=1S/C18H19NO5/c1-21-15-6-5-11(9-14(15)20)19-8-7-12-13(19)10-16(22-2)18(24-4)17(12)23-3/h5-10,20H,1-4H3 |
| InChIKey | YBIKFKKPMZWZNA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol?
The IUPAC name of 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol (CID 54768181) is 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol.
What is the SMILES notation for 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol?
The canonical SMILES for 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol is COc1ccc(-n2ccc3c(OC)c(OC)c(OC)cc32)cc1O.
What is the InChIKey of 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol?
The InChIKey is YBIKFKKPMZWZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-21-15-6-5-11(9-14(15)20)19-8-7-12-13(19)10-16(22-2)18(24-4)17(12)23-3/h5-10,20H,1-4H3.
What are the key properties of 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol?
2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol has a molecular weight of 329.35 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(4,5,6-trimethoxyindol-1-yl)phenol is sourced from PubChem (CID 54768181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).