About N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline
N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline (PubChem CID 54768182) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline |
| PubChem CID | 54768182 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline |
| SMILES | COc1cc2c(ccn2-c2ccc(N(C)C)cc2)c(OC)c1OC |
| InChI | InChI=1S/C19H22N2O3/c1-20(2)13-6-8-14(9-7-13)21-11-10-15-16(21)12-17(22-3)19(24-5)18(15)23-4/h6-12H,1-5H3 |
| InChIKey | RJSVMADFJNMPNG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline?
The IUPAC name of N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline (CID 54768182) is N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline.
What is the SMILES notation for N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline?
The canonical SMILES for N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline is COc1cc2c(ccn2-c2ccc(N(C)C)cc2)c(OC)c1OC.
What is the InChIKey of N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline?
The InChIKey is RJSVMADFJNMPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-20(2)13-6-8-14(9-7-13)21-11-10-15-16(21)12-17(22-3)19(24-5)18(15)23-4/h6-12H,1-5H3.
What are the key properties of N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline?
N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline has a molecular weight of 326.40 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-(4,5,6-trimethoxyindol-1-yl)aniline is sourced from PubChem (CID 54768182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).