About 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline
6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline (PubChem CID 54768186) has the molecular formula C21H20N2O4
and a molecular weight of 364.40 g/mol. Its IUPAC name is 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline.
Molecular Properties
| Compound Name | 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline |
| PubChem CID | 54768186 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline |
| SMILES | COc1ccc2nc(-n3ccc4c(OC)c(OC)c(OC)cc43)ccc2c1 |
| InChI | InChI=1S/C21H20N2O4/c1-24-14-6-7-16-13(11-14)5-8-19(22-16)23-10-9-15-17(23)12-18(25-2)21(27-4)20(15)26-3/h5-12H,1-4H3 |
| InChIKey | HLZSZPSMLWCZKJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline?
The IUPAC name of 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline (CID 54768186) is 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline.
What is the SMILES notation for 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline?
The canonical SMILES for 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline is COc1ccc2nc(-n3ccc4c(OC)c(OC)c(OC)cc43)ccc2c1.
What is the InChIKey of 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline?
The InChIKey is HLZSZPSMLWCZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O4/c1-24-14-6-7-16-13(11-14)5-8-19(22-16)23-10-9-15-17(23)12-18(25-2)21(27-4)20(15)26-3/h5-12H,1-4H3.
What are the key properties of 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline?
6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline has a molecular weight of 364.40 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-(4,5,6-trimethoxyindol-1-yl)quinoline is sourced from PubChem (CID 54768186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).