About N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide
N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 54768282) has the molecular formula C10H13N3O4
and a molecular weight of 239.23 g/mol. Its IUPAC name is N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| PubChem CID | 54768282 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ccn([C@H]2C[C@@H](O)CO2)c(=O)n1 |
| InChI | InChI=1S/C10H13N3O4/c1-6(14)11-8-2-3-13(10(16)12-8)9-4-7(15)5-17-9/h2-3,7,9,15H,4-5H2,1H3,(H,11,12,14,16)/t7-,9-/m1/s1 |
| InChIKey | LCBWYRGPOFZIKH-VXNVDRBHSA-N |
| XLogP | -0.52 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
The IUPAC name of N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (CID 54768282) is N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
The canonical SMILES for N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide is CC(=O)Nc1ccn([C@H]2C[C@@H](O)CO2)c(=O)n1.
What is the InChIKey of N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
The InChIKey is LCBWYRGPOFZIKH-VXNVDRBHSA-N. The full InChI is InChI=1S/C10H13N3O4/c1-6(14)11-8-2-3-13(10(16)12-8)9-4-7(15)5-17-9/h2-3,7,9,15H,4-5H2,1H3,(H,11,12,14,16)/t7-,9-/m1/s1.
What are the key properties of N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide?
N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide has a molecular weight of 239.23 g/mol, XLogP of -0.52, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(2R,4R)-4-hydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide is sourced from PubChem (CID 54768282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).