About 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one
4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 54768283) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| PubChem CID | 54768283 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2C[C@@H](O)CO2)c(=O)n1 |
| InChI | InChI=1S/C8H11N3O3/c9-6-1-2-11(8(13)10-6)7-3-5(12)4-14-7/h1-2,5,7,12H,3-4H2,(H2,9,10,13)/t5-,7-/m1/s1 |
| InChIKey | RBMLXEFQJQPSGL-IYSWYEEDSA-N |
| XLogP | -0.89 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one?
The IUPAC name of 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one (CID 54768283) is 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
What is the SMILES notation for 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one?
The canonical SMILES for 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one is Nc1ccn([C@H]2C[C@@H](O)CO2)c(=O)n1.
What is the InChIKey of 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one?
The InChIKey is RBMLXEFQJQPSGL-IYSWYEEDSA-N. The full InChI is InChI=1S/C8H11N3O3/c9-6-1-2-11(8(13)10-6)7-3-5(12)4-14-7/h1-2,5,7,12H,3-4H2,(H2,9,10,13)/t5-,7-/m1/s1.
What are the key properties of 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one?
4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one has a molecular weight of 197.19 g/mol, XLogP of -0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(2R,4R)-4-hydroxyoxolan-2-yl]pyrimidin-2-one is sourced from PubChem (CID 54768283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).