C12H10N6O4S2 — CID 54768321
7-(anilinocarbamoyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-2-sulfonamide (PubChem CID 54768321) has the molecular formula C12H10N6O4S2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 7-(anilinocarbamoyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-2-sulfonamide.
| Compound Name | 7-(anilinocarbamoyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 54768321 |
| Molecular Formula | C12H10N6O4S2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 7-(anilinocarbamoyl)-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nn2c(=O)cc(C(=O)NNc3ccccc3)nc2s1 |
| InChI | InChI=1S/C12H10N6O4S2/c13-24(21,22)12-17-18-9(19)6-8(14-11(18)23-12)10(20)16-15-7-4-2-1-3-5-7/h1-6,15H,(H,16,20)(H2,13,21,22) |
| InChIKey | AUJPDRGNZFNECT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 148.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|