About tert-butyl (E)-4,4,4-trifluorobut-2-enoate
tert-butyl (E)-4,4,4-trifluorobut-2-enoate (PubChem CID 54768627) has the molecular formula C8H11F3O2
and a molecular weight of 196.17 g/mol. Its IUPAC name is tert-butyl (E)-4,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-4,4,4-trifluorobut-2-enoate |
| PubChem CID | 54768627 |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | tert-butyl (E)-4,4,4-trifluorobut-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2/c1-7(2,3)13-6(12)4-5-8(9,10)11/h4-5H,1-3H3/b5-4+ |
| InChIKey | AMBVAEUIRPBJOA-SNAWJCMRSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-4,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-4,4,4-trifluorobut-2-enoate?
The IUPAC name of tert-butyl (E)-4,4,4-trifluorobut-2-enoate (CID 54768627) is tert-butyl (E)-4,4,4-trifluorobut-2-enoate.
What is the SMILES notation for tert-butyl (E)-4,4,4-trifluorobut-2-enoate?
The canonical SMILES for tert-butyl (E)-4,4,4-trifluorobut-2-enoate is CC(C)(C)OC(=O)/C=C/C(F)(F)F.
What is the InChIKey of tert-butyl (E)-4,4,4-trifluorobut-2-enoate?
The InChIKey is AMBVAEUIRPBJOA-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H11F3O2/c1-7(2,3)13-6(12)4-5-8(9,10)11/h4-5H,1-3H3/b5-4+.
What are the key properties of tert-butyl (E)-4,4,4-trifluorobut-2-enoate?
tert-butyl (E)-4,4,4-trifluorobut-2-enoate has a molecular weight of 196.17 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-4,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 54768627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).