C20H15ClN6OS — CID 54768888
3-[6-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-1-ethyl-7-methyl-1,8-naphthyridin-4-one (PubChem CID 54768888) has the molecular formula C20H15ClN6OS and a molecular weight of 422.90 g/mol. Its IUPAC name is 3-[6-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-1-ethyl-7-methyl-1,8-naphthyridin-4-one.
| Compound Name | 3-[6-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-1-ethyl-7-methyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 54768888 |
| Molecular Formula | C20H15ClN6OS |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 3-[6-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]-1-ethyl-7-methyl-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(-c2nnc3sc(-c4ccc(Cl)cc4)nn23)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C20H15ClN6OS/c1-3-26-10-15(16(28)14-9-4-11(2)22-17(14)26)18-23-24-20-27(18)25-19(29-20)12-5-7-13(21)8-6-12/h4-10H,3H2,1-2H3 |
| InChIKey | KXDSLXAQYJOOBW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |