About N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide
N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide (PubChem CID 54768933) has the molecular formula C23H24N2O2
and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide |
| PubChem CID | 54768933 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide |
| SMILES | O=C(NC1C[C@H]2CC[C@@H](C1)N2Cc1ccco1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H24N2O2/c26-23(18-8-7-16-4-1-2-5-17(16)12-18)24-19-13-20-9-10-21(14-19)25(20)15-22-6-3-11-27-22/h1-8,11-12,19-21H,9-10,13-15H2,(H,24,26)/t19?,20-,21+ |
| InChIKey | IILPLAOABJATAZ-SEJPIABJSA-N |
| XLogP | 4.36 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide?
The IUPAC name of N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide (CID 54768933) is N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide.
What is the SMILES notation for N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide?
The canonical SMILES for N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide is O=C(NC1C[C@H]2CC[C@@H](C1)N2Cc1ccco1)c1ccc2ccccc2c1.
What is the InChIKey of N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide?
The InChIKey is IILPLAOABJATAZ-SEJPIABJSA-N. The full InChI is InChI=1S/C23H24N2O2/c26-23(18-8-7-16-4-1-2-5-17(16)12-18)24-19-13-20-9-10-21(14-19)25(20)15-22-6-3-11-27-22/h1-8,11-12,19-21H,9-10,13-15H2,(H,24,26)/t19?,20-,21+.
What are the key properties of N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide?
N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide has a molecular weight of 360.46 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,5S)-8-(furan-2-ylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]naphthalene-2-carboxamide is sourced from PubChem (CID 54768933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).