About (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one
(E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one (PubChem CID 54769155) has the molecular formula C25H18Cl2N2O2
and a molecular weight of 449.34 g/mol. Its IUPAC name is (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one |
| PubChem CID | 54769155 |
| Molecular Formula | C25H18Cl2N2O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-n2ccnc2)cc1)c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H18Cl2N2O2/c26-21-7-4-20(24(27)15-21)16-31-23-10-5-19(6-11-23)25(30)12-3-18-1-8-22(9-2-18)29-14-13-28-17-29/h1-15,17H,16H2/b12-3+ |
| InChIKey | MEUZUVCZMYVHNO-KGVSQERTSA-N |
| XLogP | 6.65 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one?
The IUPAC name of (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one (CID 54769155) is (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one is O=C(/C=C/c1ccc(-n2ccnc2)cc1)c1ccc(OCc2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one?
The InChIKey is MEUZUVCZMYVHNO-KGVSQERTSA-N. The full InChI is InChI=1S/C25H18Cl2N2O2/c26-21-7-4-20(24(27)15-21)16-31-23-10-5-19(6-11-23)25(30)12-3-18-1-8-22(9-2-18)29-14-13-28-17-29/h1-15,17H,16H2/b12-3+.
What are the key properties of (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one?
(E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one has a molecular weight of 449.34 g/mol, XLogP of 6.65, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-3-(4-imidazol-1-ylphenyl)prop-2-en-1-one is sourced from PubChem (CID 54769155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).