C21H18N4O4 — CID 54769178
4-[3-(2,6-dimethylanilino)-6-nitroimidazo[1,2-a]pyridin-2-yl]benzene-1,3-diol (PubChem CID 54769178) has the molecular formula C21H18N4O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-[3-(2,6-dimethylanilino)-6-nitroimidazo[1,2-a]pyridin-2-yl]benzene-1,3-diol.
| Compound Name | 4-[3-(2,6-dimethylanilino)-6-nitroimidazo[1,2-a]pyridin-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 54769178 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-[3-(2,6-dimethylanilino)-6-nitroimidazo[1,2-a]pyridin-2-yl]benzene-1,3-diol |
| SMILES | Cc1cccc(C)c1Nc1c(-c2ccc(O)cc2O)nc2ccc([N+](=O)[O-])cn12 |
| InChI | InChI=1S/C21H18N4O4/c1-12-4-3-5-13(2)19(12)23-21-20(16-8-7-15(26)10-17(16)27)22-18-9-6-14(25(28)29)11-24(18)21/h3-11,23,26-27H,1-2H3 |
| InChIKey | GHTFRLHOFPAVIJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|