C15H21N3O7 — CID 54769193
2-nitro-1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]imidazole (PubChem CID 54769193) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-nitro-1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]imidazole.
| Compound Name | 2-nitro-1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]imidazole |
|---|---|
| PubChem CID | 54769193 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-nitro-1-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]imidazole |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](Cn1ccnc1[N+](=O)[O-])O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C15H21N3O7/c1-14(2)22-9-8(7-17-6-5-16-13(17)18(19)20)21-12-11(10(9)23-14)24-15(3,4)25-12/h5-6,8-12H,7H2,1-4H3/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | WXSROVVFNCCSFO-YBXAARCKSA-N |
| XLogP | 1.19 |
| TPSA | 107.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|