C20H18N2O2 — CID 54769208
N-benzyl-5-(3-formylphenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 54769208) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-benzyl-5-(3-formylphenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-benzyl-5-(3-formylphenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54769208 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-benzyl-5-(3-formylphenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1c(C(=O)NCc2ccccc2)ccc1-c1cccc(C=O)c1 |
| InChI | InChI=1S/C20H18N2O2/c1-22-18(17-9-5-8-16(12-17)14-23)10-11-19(22)20(24)21-13-15-6-3-2-4-7-15/h2-12,14H,13H2,1H3,(H,21,24) |
| InChIKey | XVNJEHZQJHJWOP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|