C32H36O3 — CID 54769376
(8R,9S,13S,14S,17R)-13-methyl-17-[(3-phenylmethoxyphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 54769376) has the molecular formula C32H36O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-13-methyl-17-[(3-phenylmethoxyphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-13-methyl-17-[(3-phenylmethoxyphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 54769376 |
| Molecular Formula | C32H36O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (8R,9S,13S,14S,17R)-13-methyl-17-[(3-phenylmethoxyphenyl)methyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H36O3/c1-31-16-14-28-27-13-11-25(33)19-24(27)10-12-29(28)30(31)15-17-32(31,34)20-23-8-5-9-26(18-23)35-21-22-6-3-2-4-7-22/h2-9,11,13,18-19,28-30,33-34H,10,12,14-17,20-21H2,1H3/t28-,29-,30+,31+,32-/m1/s1 |
| InChIKey | HVNIQFLKEHCWQE-DSSMMGBBSA-N |
| XLogP | 6.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |