C39H42O4 — CID 54769598
(8R,9S,13S,14S,17R)-17-[[3,5-bis(phenylmethoxy)phenyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 54769598) has the molecular formula C39H42O4 and a molecular weight of 574.76 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-17-[[3,5-bis(phenylmethoxy)phenyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-17-[[3,5-bis(phenylmethoxy)phenyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 54769598 |
| Molecular Formula | C39H42O4 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-[[3,5-bis(phenylmethoxy)phenyl]methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)Cc1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C39H42O4/c1-38-18-16-35-34-15-13-31(40)22-30(34)12-14-36(35)37(38)17-19-39(38,41)24-29-20-32(42-25-27-8-4-2-5-9-27)23-33(21-29)43-26-28-10-6-3-7-11-28/h2-11,13,15,20-23,35-37,40-41H,12,14,16-19,24-26H2,1H3/t35-,36-,37+,38+,39-/m1/s1 |
| InChIKey | AALGEJQIERLACX-WEMFOFRKSA-N |
| XLogP | 8.38 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |