About (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one
(2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one (PubChem CID 54769686) has the molecular formula C25H24BrNO3
and a molecular weight of 466.38 g/mol. Its IUPAC name is (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one.
Molecular Properties
| Compound Name | (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one |
| PubChem CID | 54769686 |
| Molecular Formula | C25H24BrNO3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one |
| SMILES | CC[C@@H](c1ccccc1)[C@@H](C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H24BrNO3/c1-2-22(18-9-5-3-6-10-18)24(25(28)20-11-7-4-8-12-20)23(17-27(29)30)19-13-15-21(26)16-14-19/h3-16,22-24H,2,17H2,1H3/t22-,23+,24+/m0/s1 |
| InChIKey | JMYFJQAVWIPTSS-RBZQAINGSA-N |
| XLogP | 6.50 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one?
The IUPAC name of (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one (CID 54769686) is (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one.
What is the SMILES notation for (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one?
The canonical SMILES for (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one is CC[C@@H](c1ccccc1)[C@@H](C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(Br)cc1.
What is the InChIKey of (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one?
The InChIKey is JMYFJQAVWIPTSS-RBZQAINGSA-N. The full InChI is InChI=1S/C25H24BrNO3/c1-2-22(18-9-5-3-6-10-18)24(25(28)20-11-7-4-8-12-20)23(17-27(29)30)19-13-15-21(26)16-14-19/h3-16,22-24H,2,17H2,1H3/t22-,23+,24+/m0/s1.
What are the key properties of (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one?
(2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one has a molecular weight of 466.38 g/mol, XLogP of 6.50, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-1,3-diphenylpentan-1-one is sourced from PubChem (CID 54769686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).