C25H28Br2O2 — CID 54769805
(8R,9S,13S,14S,17R)-17-[(3,5-dibromophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 54769805) has the molecular formula C25H28Br2O2 and a molecular weight of 520.31 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-17-[(3,5-dibromophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-17-[(3,5-dibromophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 54769805 |
| Molecular Formula | C25H28Br2O2 |
| Molecular Weight | 520.31 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-[(3,5-dibromophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)Cc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C25H28Br2O2/c1-24-8-6-21-20-5-3-19(28)12-16(20)2-4-22(21)23(24)7-9-25(24,29)14-15-10-17(26)13-18(27)11-15/h3,5,10-13,21-23,28-29H,2,4,6-9,14H2,1H3/t21-,22-,23+,24+,25-/m1/s1 |
| InChIKey | NMKGDEPDTUNPOO-WJGLBBAVSA-N |
| XLogP | 6.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.31 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |