C24H28F3N5O2 — CID 54769956
N-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide (PubChem CID 54769956) has the molecular formula C24H28F3N5O2 and a molecular weight of 475.52 g/mol. Its IUPAC name is N-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide.
| Compound Name | N-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 54769956 |
| Molecular Formula | C24H28F3N5O2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[1-[4-(2,5-dihydrofuran-2-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide |
| SMILES | O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)NC1CN(C2CCC(C3C=CCO3)CC2)C1 |
| InChI | InChI=1S/C24H28F3N5O2/c25-24(26,27)16-5-8-20-19(10-16)23(30-14-29-20)28-11-22(33)31-17-12-32(13-17)18-6-3-15(4-7-18)21-2-1-9-34-21/h1-2,5,8,10,14-15,17-18,21H,3-4,6-7,9,11-13H2,(H,31,33)(H,28,29,30) |
| InChIKey | BMCBGVGHMBKTAC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|