C13H10O6 — CID 54769974
3,5,11,14-tetraoxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12)-triene-8,17-dione (PubChem CID 54769974) has the molecular formula C13H10O6 and a molecular weight of 262.22 g/mol. Its IUPAC name is 3,5,11,14-tetraoxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12)-triene-8,17-dione.
| Compound Name | 3,5,11,14-tetraoxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12)-triene-8,17-dione |
|---|---|
| PubChem CID | 54769974 |
| Molecular Formula | C13H10O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3,5,11,14-tetraoxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12)-triene-8,17-dione |
| SMILES | O=C1CCOc2c3c(c4c(c21)OCO4)C(=O)CCO3 |
| InChI | InChI=1S/C13H10O6/c14-6-1-3-16-10-8(6)12-13(19-5-18-12)9-7(15)2-4-17-11(9)10/h1-5H2 |
| InChIKey | IDZPMOCHIDXCIS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |