C31H40N6O7S — CID 54770012
N-(diaminomethylidene)-3-[(4-methylphenyl)sulfonylamino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide (PubChem CID 54770012) has the molecular formula C31H40N6O7S and a molecular weight of 640.76 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-[(4-methylphenyl)sulfonylamino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide.
| Compound Name | N-(diaminomethylidene)-3-[(4-methylphenyl)sulfonylamino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide |
|---|---|
| PubChem CID | 54770012 |
| Molecular Formula | C31H40N6O7S |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | N-(diaminomethylidene)-3-[(4-methylphenyl)sulfonylamino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide |
| SMILES | COc1ccc(CN2CCN(CCOc3ccc(C(=O)N=C(N)N)cc3NS(=O)(=O)c3ccc(C)cc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C31H40N6O7S/c1-21-5-9-24(10-6-21)45(39,40)35-25-19-22(30(38)34-31(32)33)7-11-26(25)44-18-17-36-13-15-37(16-14-36)20-23-8-12-27(41-2)29(43-4)28(23)42-3/h5-12,19,35H,13-18,20H2,1-4H3,(H4,32,33,34,38) |
| InChIKey | ZWWMKZCRQWIVFE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|