C17H23N3O2 — CID 54770046
N,N-dibutyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 54770046) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N,N-dibutyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N,N-dibutyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 54770046 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N,N-dibutyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C17H23N3O2/c1-3-5-12-20(13-6-4-2)17(21)16-18-15(19-22-16)14-10-8-7-9-11-14/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | ZWPXOOPRMJRRLA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |