C19H27N3O2 — CID 54770047
N,N-dipentyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 54770047) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N,N-dipentyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N,N-dipentyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 54770047 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N,N-dipentyl-3-phenyl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H27N3O2/c1-3-5-10-14-22(15-11-6-4-2)19(23)18-20-17(21-24-18)16-12-8-7-9-13-16/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3 |
| InChIKey | HIPHOFADNGEPRN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|