C15H19NO2S — CID 54770069
5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-thiophen-2-yl-1,4,2-dioxazole (PubChem CID 54770069) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-thiophen-2-yl-1,4,2-dioxazole.
| Compound Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-thiophen-2-yl-1,4,2-dioxazole |
|---|---|
| PubChem CID | 54770069 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3-thiophen-2-yl-1,4,2-dioxazole |
| SMILES | CC(C)=CCC/C(C)=C/C1ON=C(c2cccs2)O1 |
| InChI | InChI=1S/C15H19NO2S/c1-11(2)6-4-7-12(3)10-14-17-15(16-18-14)13-8-5-9-19-13/h5-6,8-10,14H,4,7H2,1-3H3/b12-10+ |
| InChIKey | ZJJNSVAVMRBBGB-ZRDIBKRKSA-N |
| XLogP | 4.48 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|