C34H44N6O6 — CID 54770226
N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide (PubChem CID 54770226) has the molecular formula C34H44N6O6 and a molecular weight of 632.76 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide.
| Compound Name | N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 54770226 |
| Molecular Formula | C34H44N6O6 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide |
| SMILES | CCc1ccc(C(=O)Nc2cc(C(=O)N=C(N)N)ccc2OCCCN2CCN(Cc3ccc(OC)c(OC)c3OC)CC2)cc1 |
| InChI | InChI=1S/C34H44N6O6/c1-5-23-7-9-24(10-8-23)32(41)37-27-21-25(33(42)38-34(35)36)11-13-28(27)46-20-6-15-39-16-18-40(19-17-39)22-26-12-14-29(43-2)31(45-4)30(26)44-3/h7-14,21H,5-6,15-20,22H2,1-4H3,(H,37,41)(H4,35,36,38,42) |
| InChIKey | PEDLWHVYCCZYHA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|