About N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide
N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 54770263) has the molecular formula C20H28N2O2
and a molecular weight of 328.46 g/mol. Its IUPAC name is N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 54770263 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H28N2O2/c1-3-5-10-14-22(15-11-6-4-2)20(23)18-16-24-19(21-18)17-12-8-7-9-13-17/h7-9,12-13,16H,3-6,10-11,14-15H2,1-2H3 |
| InChIKey | NSJCPYMFWNFMHI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide (CID 54770263) is N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide is CCCCCN(CCCCC)C(=O)c1coc(-c2ccccc2)n1.
What is the InChIKey of N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide?
The InChIKey is NSJCPYMFWNFMHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O2/c1-3-5-10-14-22(15-11-6-4-2)20(23)18-16-24-19(21-18)17-12-8-7-9-13-17/h7-9,12-13,16H,3-6,10-11,14-15H2,1-2H3.
What are the key properties of N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide?
N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide has a molecular weight of 328.46 g/mol, XLogP of 5.16, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipentyl-2-phenyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 54770263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).