About CID 5477031
CID 5477031 (PubChem CID 5477031) has the molecular formula C7H17N3
and a molecular weight of 143.23 g/mol.
Molecular Properties
| Compound Name | CID 5477031 |
| PubChem CID | 5477031 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | — |
| SMILES | CN(CCC[NH])CCC[NH] |
| InChI | InChI=1S/C7H17N3/c1-10(6-2-4-8)7-3-5-9/h8-9H,2-7H2,1H3 |
| InChIKey | UFDOJQILJNFDAC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 5477031 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5477031?
The IUPAC name of CID 5477031 (CID 5477031) is not available.
What is the SMILES notation for CID 5477031?
The canonical SMILES for CID 5477031 is CN(CCC[NH])CCC[NH].
What is the InChIKey of CID 5477031?
The InChIKey is UFDOJQILJNFDAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3/c1-10(6-2-4-8)7-3-5-9/h8-9H,2-7H2,1H3.
What are the key properties of CID 5477031?
CID 5477031 has a molecular weight of 143.23 g/mol, XLogP of 0.26, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5477031 is sourced from PubChem (CID 5477031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).