C27H37F13O3Si2 — CID 54770335
1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-one (PubChem CID 54770335) has the molecular formula C27H37F13O3Si2 and a molecular weight of 712.74 g/mol. Its IUPAC name is 1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-one.
| Compound Name | 1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-one |
|---|---|
| PubChem CID | 54770335 |
| Molecular Formula | C27H37F13O3Si2 |
| Molecular Weight | 712.74 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | 1-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(CO[Si](C)(C)C(C)(C)C)cc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H37F13O3Si2/c1-20(2,3)44(7,8)42-14-16-11-17(15-43-45(9,10)21(4,5)6)13-18(12-16)19(41)22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40/h11-13H,14-15H2,1-10H3 |
| InChIKey | ORKNYFGKPMRLBL-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.74 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|