C18H24N2O2 — CID 54770484
N,N-dibutyl-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 54770484) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N,N-dibutyl-3-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N,N-dibutyl-3-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 54770484 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N,N-dibutyl-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-5-12-20(13-6-4-2)18(21)17-14-16(19-22-17)15-10-8-7-9-11-15/h7-11,14H,3-6,12-13H2,1-2H3 |
| InChIKey | OALJCTDQPHKHKT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |