C31H40N6O6S — CID 54770666
N-[5-(diaminomethylidenecarbamoyl)-2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]phenyl]-3-methylthiophene-2-carboxamide (PubChem CID 54770666) has the molecular formula C31H40N6O6S and a molecular weight of 624.76 g/mol. Its IUPAC name is N-[5-(diaminomethylidenecarbamoyl)-2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]phenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[5-(diaminomethylidenecarbamoyl)-2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]phenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 54770666 |
| Molecular Formula | C31H40N6O6S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | N-[5-(diaminomethylidenecarbamoyl)-2-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]phenyl]-3-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(CN2CCN(CCCOc3ccc(C(=O)N=C(N)N)cc3NC(=O)c3sccc3C)CC2)c(OC)c1OC |
| InChI | InChI=1S/C31H40N6O6S/c1-20-10-17-44-28(20)30(39)34-23-18-21(29(38)35-31(32)33)6-8-24(23)43-16-5-11-36-12-14-37(15-13-36)19-22-7-9-25(40-2)27(42-4)26(22)41-3/h6-10,17-18H,5,11-16,19H2,1-4H3,(H,34,39)(H4,32,33,35,38) |
| InChIKey | BXRRBFIFVZRKCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|