C27H34F3N5O2 — CID 54770833
N-[1-[4-(4-hydroxyhepta-1,6-dien-4-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide (PubChem CID 54770833) has the molecular formula C27H34F3N5O2 and a molecular weight of 517.60 g/mol. Its IUPAC name is N-[1-[4-(4-hydroxyhepta-1,6-dien-4-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide.
| Compound Name | N-[1-[4-(4-hydroxyhepta-1,6-dien-4-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide |
|---|---|
| PubChem CID | 54770833 |
| Molecular Formula | C27H34F3N5O2 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | N-[1-[4-(4-hydroxyhepta-1,6-dien-4-yl)cyclohexyl]azetidin-3-yl]-2-[[6-(trifluoromethyl)quinazolin-4-yl]amino]acetamide |
| SMILES | C=CCC(O)(CC=C)C1CCC(N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1 |
| InChI | InChI=1S/C27H34F3N5O2/c1-3-11-26(37,12-4-2)18-5-8-21(9-6-18)35-15-20(16-35)34-24(36)14-31-25-22-13-19(27(28,29)30)7-10-23(22)32-17-33-25/h3-4,7,10,13,17-18,20-21,37H,1-2,5-6,8-9,11-12,14-16H2,(H,34,36)(H,31,32,33) |
| InChIKey | DKYWOOLTRZJAPA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|