C19H19N3O4S — CID 54770855
N-[5-(2-methoxyethoxy)-2,3-dihydro-1H-inden-1-yl]-3-oxo-[1,2]thiazolo[5,4-b]pyridine-2-carboxamide (PubChem CID 54770855) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[5-(2-methoxyethoxy)-2,3-dihydro-1H-inden-1-yl]-3-oxo-[1,2]thiazolo[5,4-b]pyridine-2-carboxamide.
| Compound Name | N-[5-(2-methoxyethoxy)-2,3-dihydro-1H-inden-1-yl]-3-oxo-[1,2]thiazolo[5,4-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54770855 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[5-(2-methoxyethoxy)-2,3-dihydro-1H-inden-1-yl]-3-oxo-[1,2]thiazolo[5,4-b]pyridine-2-carboxamide |
| SMILES | COCCOc1ccc2c(c1)CCC2NC(=O)n1sc2ncccc2c1=O |
| InChI | InChI=1S/C19H19N3O4S/c1-25-9-10-26-13-5-6-14-12(11-13)4-7-16(14)21-19(24)22-18(23)15-3-2-8-20-17(15)27-22/h2-3,5-6,8,11,16H,4,7,9-10H2,1H3,(H,21,24) |
| InChIKey | XAVSLDRRMBFTHI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|