C14H14ClFN6S — CID 54771164
2-[(E)-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride (PubChem CID 54771164) has the molecular formula C14H14ClFN6S and a molecular weight of 352.83 g/mol. Its IUPAC name is 2-[(E)-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 54771164 |
| Molecular Formula | C14H14ClFN6S |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[(E)-[6-(4-fluorophenyl)-2-methylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]guanidine;hydrochloride |
| SMILES | Cc1cn2c(/C=N/N=C(N)N)c(-c3ccc(F)cc3)nc2s1.Cl |
| InChI | InChI=1S/C14H13FN6S.ClH/c1-8-7-21-11(6-18-20-13(16)17)12(19-14(21)22-8)9-2-4-10(15)5-3-9;/h2-7H,1H3,(H4,16,17,20);1H/b18-6+; |
| InChIKey | AWEQOHYSEQSECG-TWFGXWKLSA-N |
| XLogP | 2.54 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|