C22H27FN4O5 — CID 54771587
1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-hydroxyiminopropyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 54771587) has the molecular formula C22H27FN4O5 and a molecular weight of 446.48 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-hydroxyiminopropyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-hydroxyiminopropyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 54771587 |
| Molecular Formula | C22H27FN4O5 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-hydroxyiminopropyl]-3-methylpiperazin-1-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(N2CCN(C/C(C)=N/O)C(C)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C22H27FN4O5/c1-12(24-31)9-25-6-7-26(10-13(25)2)19-17(23)8-15-18(21(19)32-3)27(14-4-5-14)11-16(20(15)28)22(29)30/h8,11,13-14,31H,4-7,9-10H2,1-3H3,(H,29,30)/b24-12+ |
| InChIKey | AJEJDHXVKAVKON-WYMPLXKRSA-N |
| XLogP | 2.54 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|