C22H28O4 — CID 547717
dimethyl 1,2-di(cyclohexen-1-yl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate (PubChem CID 547717) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is dimethyl 1,2-di(cyclohexen-1-yl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate.
| Compound Name | dimethyl 1,2-di(cyclohexen-1-yl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate |
|---|---|
| PubChem CID | 547717 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | dimethyl 1,2-di(cyclohexen-1-yl)tricyclo[3.1.0.02,4]hexane-3,6-dicarboxylate |
| SMILES | COC(=O)C1C2C3C(C(=O)OC)C3(C3=CCCCC3)C12C1=CCCCC1 |
| InChI | InChI=1S/C22H28O4/c1-25-19(23)17-15-16-18(20(24)26-2)22(16,14-11-7-4-8-12-14)21(15,17)13-9-5-3-6-10-13/h9,11,15-18H,3-8,10,12H2,1-2H3 |
| InChIKey | JSBIFZBUGDHNNT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|