About 1-benzyl-4-hexyltriazole
1-benzyl-4-hexyltriazole (PubChem CID 54772019) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-benzyl-4-hexyltriazole.
Molecular Properties
| Compound Name | 1-benzyl-4-hexyltriazole |
| PubChem CID | 54772019 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-benzyl-4-hexyltriazole |
| SMILES | CCCCCCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C15H21N3/c1-2-3-4-8-11-15-13-18(17-16-15)12-14-9-6-5-7-10-14/h5-7,9-10,13H,2-4,8,11-12H2,1H3 |
| InChIKey | FXKPYNYHIYSBFS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-hexyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-hexyltriazole?
The IUPAC name of 1-benzyl-4-hexyltriazole (CID 54772019) is 1-benzyl-4-hexyltriazole.
What is the SMILES notation for 1-benzyl-4-hexyltriazole?
The canonical SMILES for 1-benzyl-4-hexyltriazole is CCCCCCc1cn(Cc2ccccc2)nn1.
What is the InChIKey of 1-benzyl-4-hexyltriazole?
The InChIKey is FXKPYNYHIYSBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-2-3-4-8-11-15-13-18(17-16-15)12-14-9-6-5-7-10-14/h5-7,9-10,13H,2-4,8,11-12H2,1H3.
What are the key properties of 1-benzyl-4-hexyltriazole?
1-benzyl-4-hexyltriazole has a molecular weight of 243.35 g/mol, XLogP of 3.45, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-hexyltriazole is sourced from PubChem (CID 54772019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).