About [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid
[3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid (PubChem CID 54772334) has the molecular formula C8H7BN2O3
and a molecular weight of 189.97 g/mol. Its IUPAC name is [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| PubChem CID | 54772334 |
| Molecular Formula | C8H7BN2O3 |
| Molecular Weight | 189.97 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| SMILES | OB(O)c1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C8H7BN2O3/c12-9(13)7-3-1-2-6(4-7)8-10-5-14-11-8/h1-5,12-13H |
| InChIKey | OQSRASPOYZUEBV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.97 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid?
The IUPAC name of [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CID 54772334) is [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid.
What is the SMILES notation for [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid?
The canonical SMILES for [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid is OB(O)c1cccc(-c2ncon2)c1.
What is the InChIKey of [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid?
The InChIKey is OQSRASPOYZUEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BN2O3/c12-9(13)7-3-1-2-6(4-7)8-10-5-14-11-8/h1-5,12-13H.
What are the key properties of [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid?
[3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid has a molecular weight of 189.97 g/mol, XLogP of -0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,2,4-oxadiazol-3-yl)phenyl]boronic acid is sourced from PubChem (CID 54772334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).